C20H38O6Si — CID 10501305
(3S)-3-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]butane-1,2-diol (PubChem CID 10501305) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is (3S)-3-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]butane-1,2-diol.
| Compound Name | (3S)-3-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 10501305 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (3S)-3-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]butane-1,2-diol |
| SMILES | C[C@@H](C(O)CO)[C@@H]1C[C@]2(C=C[C@@H](O[Si](C)(C)C(C)(C)C)CO2)OC(C)(C)O1 |
| InChI | InChI=1S/C20H38O6Si/c1-14(16(22)12-21)17-11-20(26-19(5,6)24-17)10-9-15(13-23-20)25-27(7,8)18(2,3)4/h9-10,14-17,21-22H,11-13H2,1-8H3/t14-,15+,16?,17-,20-/m0/s1 |
| InChIKey | QOTQSOTYUVRFPZ-BFRKHNHSSA-N |
| XLogP | 3.19 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|