C21H38O6Si — CID 134864926
4-[(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl)methyl]-2-(hydroxymethyl)oxan-3-ol (PubChem CID 134864926) has the molecular formula C21H38O6Si and a molecular weight of 414.62 g/mol. Its IUPAC name is 4-[(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl)methyl]-2-(hydroxymethyl)oxan-3-ol.
| Compound Name | 4-[(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl)methyl]-2-(hydroxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 134864926 |
| Molecular Formula | C21H38O6Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 4-[(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl)methyl]-2-(hydroxymethyl)oxan-3-ol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OCC2OC(CC3CCOC(CO)C3O)C=CC2O1 |
| InChI | InChI=1S/C21H38O6Si/c1-20(2,3)28(21(4,5)6)25-13-18-16(27-28)8-7-15(26-18)11-14-9-10-24-17(12-22)19(14)23/h7-8,14-19,22-23H,9-13H2,1-6H3 |
| InChIKey | CVVCEKZDLKUZOW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|