C26H52O5Si2 — CID 159132034
(4aR,6S,7S,8aR)-2,2-ditert-butyl-6-[(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol (PubChem CID 159132034) has the molecular formula C26H52O5Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (4aR,6S,7S,8aR)-2,2-ditert-butyl-6-[(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol.
| Compound Name | (4aR,6S,7S,8aR)-2,2-ditert-butyl-6-[(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
|---|---|
| PubChem CID | 159132034 |
| Molecular Formula | C26H52O5Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (4aR,6S,7S,8aR)-2,2-ditert-butyl-6-[(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C26H52O5Si2/c1-14-15-20(30-32(12,13)24(3,4)5)18(2)23-19(27)16-21-22(29-23)17-28-33(31-21,25(6,7)8)26(9,10)11/h14-15,18-23,27H,16-17H2,1-13H3/b15-14+/t18-,19+,20+,21-,22-,23+/m1/s1 |
| InChIKey | KHACXCIHFZJZKD-IJGODXFRSA-N |
| XLogP | 6.57 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|