C29H62O4Si3 — CID 90771901
[(2R,3S,4S,6R)-6-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-methyl-2-prop-1-enyloxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 90771901) has the molecular formula C29H62O4Si3 and a molecular weight of 559.07 g/mol. Its IUPAC name is [(2R,3S,4S,6R)-6-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-methyl-2-prop-1-enyloxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,4S,6R)-6-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-methyl-2-prop-1-enyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 90771901 |
| Molecular Formula | C29H62O4Si3 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.40 |
| IUPAC Name | [(2R,3S,4S,6R)-6-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-methyl-2-prop-1-enyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC=C[C@H]1O[C@@H]([C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C29H62O4Si3/c1-18-19-23-22(2)24(32-35(14,15)28(6,7)8)20-25(31-23)26(33-36(16,17)29(9,10)11)21-30-34(12,13)27(3,4)5/h18-19,22-26H,20-21H2,1-17H3/t22-,23+,24-,25+,26-/m0/s1 |
| InChIKey | CXJFLHROZSDZQS-FYQRJBHISA-N |
| XLogP | 9.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|