C22H45IO3Si2 — CID 11376143
tert-butyl-[[(2S,3S,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]methoxy]-dimethylsilane (PubChem CID 11376143) has the molecular formula C22H45IO3Si2 and a molecular weight of 540.68 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3S,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11376143 |
| Molecular Formula | C22H45IO3Si2 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | tert-butyl-[[(2S,3S,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]methoxy]-dimethylsilane |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](C/C=C/I)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H45IO3Si2/c1-17-19(26-28(10,11)22(5,6)7)15-18(13-12-14-23)25-20(17)16-24-27(8,9)21(2,3)4/h12,14,17-20H,13,15-16H2,1-11H3/b14-12+/t17-,18+,19+,20-/m1/s1 |
| InChIKey | IKPAWSIPAPMCBI-AJVISGNCSA-N |
| XLogP | 7.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|