C25H44O5Si — CID 11351470
[(2E,4Z)-5-[(2R,3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-oxoethyl)oxan-2-yl]-4-methylpenta-2,4-dienyl] 2,2-dimethylpropanoate (PubChem CID 11351470) has the molecular formula C25H44O5Si and a molecular weight of 452.71 g/mol. Its IUPAC name is [(2E,4Z)-5-[(2R,3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-oxoethyl)oxan-2-yl]-4-methylpenta-2,4-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,4Z)-5-[(2R,3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-oxoethyl)oxan-2-yl]-4-methylpenta-2,4-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11351470 |
| Molecular Formula | C25H44O5Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | [(2E,4Z)-5-[(2R,3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-oxoethyl)oxan-2-yl]-4-methylpenta-2,4-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(=C/[C@H]1O[C@@H](CC=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C)/C=C/COC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H44O5Si/c1-18(12-11-15-28-23(27)24(3,4)5)16-21-19(2)22(17-20(29-21)13-14-26)30-31(9,10)25(6,7)8/h11-12,14,16,19-22H,13,15,17H2,1-10H3/b12-11+,18-16-/t19-,20-,21+,22-/m0/s1 |
| InChIKey | HIMIZTXHLPRGID-RZEDYFGLSA-N |
| XLogP | 5.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|