C24H50O7Si2 — CID 56958533
[(2R)-2-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]-2-hydroxyethyl] 2,2-dimethylpropanoate (PubChem CID 56958533) has the molecular formula C24H50O7Si2 and a molecular weight of 506.83 g/mol. Its IUPAC name is [(2R)-2-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]-2-hydroxyethyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]-2-hydroxyethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 56958533 |
| Molecular Formula | C24H50O7Si2 |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [(2R)-2-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]-2-hydroxyethyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1O[C@@H]([C@H](O)COC(=O)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O7Si2/c1-22(2,3)21(26)28-15-16(25)17-18(30-32(11,12)23(4,5)6)19(20(27-10)29-17)31-33(13,14)24(7,8)9/h16-20,25H,15H2,1-14H3/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | PYDBFXPIWBFQKR-LCWAXJCOSA-N |
| XLogP | 5.09 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|