C28H54O8Si2 — CID 71652916
1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-methyl-2-prop-2-enylpropanedioate (PubChem CID 71652916) has the molecular formula C28H54O8Si2 and a molecular weight of 574.90 g/mol. Its IUPAC name is 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-methyl-2-prop-2-enylpropanedioate.
| Compound Name | 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-methyl-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 71652916 |
| Molecular Formula | C28H54O8Si2 |
| Molecular Weight | 574.90 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-methyl-2-prop-2-enylpropanedioate |
| SMILES | C=CC[C@](C)(C(=O)OCC)C(=O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)O[C@@H]1C |
| InChI | InChI=1S/C28H54O8Si2/c1-16-18-28(10,24(29)32-17-2)25(30)34-20-19(3)33-23(31-11)22(36-38(14,15)27(7,8)9)21(20)35-37(12,13)26(4,5)6/h16,19-23H,1,17-18H2,2-15H3/t19-,20-,21+,22-,23+,28-/m1/s1 |
| InChIKey | SYCXDAGPHSZYEV-CRUNJEDWSA-N |
| XLogP | 6.22 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.90 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|