C29H56O10Si2 — CID 71652919
1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-(1,3-dioxolan-2-ylmethyl)-2-methylpropanedioate (PubChem CID 71652919) has the molecular formula C29H56O10Si2 and a molecular weight of 620.93 g/mol. Its IUPAC name is 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-(1,3-dioxolan-2-ylmethyl)-2-methylpropanedioate.
| Compound Name | 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-(1,3-dioxolan-2-ylmethyl)-2-methylpropanedioate |
|---|---|
| PubChem CID | 71652919 |
| Molecular Formula | C29H56O10Si2 |
| Molecular Weight | 620.93 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 3-O-ethyl (2R)-2-(1,3-dioxolan-2-ylmethyl)-2-methylpropanedioate |
| SMILES | CCOC(=O)[C@@](C)(CC1OCCO1)C(=O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)O[C@@H]1C |
| InChI | InChI=1S/C29H56O10Si2/c1-15-33-25(30)29(9,18-20-34-16-17-35-20)26(31)37-21-19(2)36-24(32-10)23(39-41(13,14)28(6,7)8)22(21)38-40(11,12)27(3,4)5/h19-24H,15-18H2,1-14H3/t19-,21-,22+,23-,24+,29-/m1/s1 |
| InChIKey | BEOIWXBNCTWBRJ-LBZQVQMVSA-N |
| XLogP | 5.40 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.93 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|