C18H39IO4Si2 — CID 11677769
tert-butyl-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-5-methoxyoxolan-3-yl]oxy-dimethylsilane (PubChem CID 11677769) has the molecular formula C18H39IO4Si2 and a molecular weight of 502.58 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-5-methoxyoxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-5-methoxyoxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11677769 |
| Molecular Formula | C18H39IO4Si2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | tert-butyl-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-5-methoxyoxolan-3-yl]oxy-dimethylsilane |
| SMILES | COC1O[C@H](CI)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H39IO4Si2/c1-17(2,3)24(8,9)22-14-13(12-19)21-16(20-7)15(14)23-25(10,11)18(4,5)6/h13-16H,12H2,1-11H3/t13-,14+,15-,16?/m1/s1 |
| InChIKey | WOUXDVYGLQGRPJ-IUOOZAAYSA-N |
| XLogP | 5.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|