C24H48O3Si2 — CID 91078694
tert-butyl-[(1S)-1-[(2R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-prop-1-enyloxan-2-yl]prop-2-enoxy]-dimethylsilane (PubChem CID 91078694) has the molecular formula C24H48O3Si2 and a molecular weight of 440.82 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-prop-1-enyloxan-2-yl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-prop-1-enyloxan-2-yl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91078694 |
| Molecular Formula | C24H48O3Si2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-prop-1-enyloxan-2-yl]prop-2-enoxy]-dimethylsilane |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](C=CC)O1 |
| InChI | InChI=1S/C24H48O3Si2/c1-14-16-20-18(3)21(27-29(12,13)24(7,8)9)17-22(25-20)19(15-2)26-28(10,11)23(4,5)6/h14-16,18-22H,2,17H2,1,3-13H3/t18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | FVOGAODTIQHPCF-BIRZXAFVSA-N |
| XLogP | 7.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|