C20H38O3Si — CID 10247580
[(2R,3aR,4S,7aS)-2-[1-(methoxymethoxy)prop-2-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10247580) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is [(2R,3aR,4S,7aS)-2-[1-(methoxymethoxy)prop-2-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3aR,4S,7aS)-2-[1-(methoxymethoxy)prop-2-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10247580 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [(2R,3aR,4S,7aS)-2-[1-(methoxymethoxy)prop-2-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC(OCOC)[C@@H]1C[C@@H]2CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C20H38O3Si/c1-8-18(22-14-21-5)16-12-15-10-9-11-19(17(15)13-16)23-24(6,7)20(2,3)4/h8,15-19H,1,9-14H2,2-7H3/t15-,16+,17+,18?,19-/m0/s1 |
| InChIKey | LJBHSJNKKCYTFS-QHEYBIKBSA-N |
| XLogP | 5.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|