C20H40O4Si — CID 10361950
3-[(2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]-3-(methoxymethoxy)propan-1-ol (PubChem CID 10361950) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is 3-[(2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]-3-(methoxymethoxy)propan-1-ol.
| Compound Name | 3-[(2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]-3-(methoxymethoxy)propan-1-ol |
|---|---|
| PubChem CID | 10361950 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 3-[(2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]-3-(methoxymethoxy)propan-1-ol |
| SMILES | COCOC(CCO)[C@@H]1C[C@@H]2CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C20H40O4Si/c1-20(2,3)25(5,6)24-19-9-7-8-15-12-16(13-17(15)19)18(10-11-21)23-14-22-4/h15-19,21H,7-14H2,1-6H3/t15-,16+,17+,18?,19-/m0/s1 |
| InChIKey | FOGAFOJTYFOPGW-QHEYBIKBSA-N |
| XLogP | 4.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|