C16H27NO4Si — CID 177424845
(3S,4R,5R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4-ethenyl-5-[(E)-hydroxyiminomethyl]oxolan-2-one (PubChem CID 177424845) has the molecular formula C16H27NO4Si and a molecular weight of 325.48 g/mol. Its IUPAC name is (3S,4R,5R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4-ethenyl-5-[(E)-hydroxyiminomethyl]oxolan-2-one.
| Compound Name | (3S,4R,5R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4-ethenyl-5-[(E)-hydroxyiminomethyl]oxolan-2-one |
|---|---|
| PubChem CID | 177424845 |
| Molecular Formula | C16H27NO4Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (3S,4R,5R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4-ethenyl-5-[(E)-hydroxyiminomethyl]oxolan-2-one |
| SMILES | C=C[C@@H]1[C@@H]([C@H](C=C)O[Si](C)(C)C(C)(C)C)C(=O)O[C@H]1/C=N/O |
| InChI | InChI=1S/C16H27NO4Si/c1-8-11-13(10-17-19)20-15(18)14(11)12(9-2)21-22(6,7)16(3,4)5/h8-14,19H,1-2H2,3-7H3/b17-10+/t11-,12-,13-,14-/m0/s1 |
| InChIKey | GOIIHUOOXPXLSA-CGQAGYHVSA-N |
| XLogP | 3.37 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|