C19H30O3Si — CID 101461673
(1R,3'S,4R,5S)-3'-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one (PubChem CID 101461673) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is (1R,3'S,4R,5S)-3'-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one.
| Compound Name | (1R,3'S,4R,5S)-3'-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one |
|---|---|
| PubChem CID | 101461673 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1R,3'S,4R,5S)-3'-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)OC[C@]12C[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C19H30O3Si/c1-7-15(22-23(5,6)18(2,3)4)16-17(20)21-12-19(16)11-13-8-9-14(19)10-13/h7-9,13-16H,1,10-12H2,2-6H3/t13-,14+,15+,16+,19+/m1/s1 |
| InChIKey | FBUPROGBGVYJDP-CUGJGTHOSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|