C21H34O4Si — CID 11559916
(3S,6S,9S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]-6,9-bis(ethenyl)-1-oxaspiro[4.4]nonan-2-one (PubChem CID 11559916) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is (3S,6S,9S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]-6,9-bis(ethenyl)-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (3S,6S,9S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]-6,9-bis(ethenyl)-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 11559916 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (3S,6S,9S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]-6,9-bis(ethenyl)-1-oxaspiro[4.4]nonan-2-one |
| SMILES | C=C[C@@H]1CC[C@@H](C=C)C12C[C@@H](C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)C(=O)O2 |
| InChI | InChI=1S/C21H34O4Si/c1-9-15-11-12-16(10-2)21(15)13-17(19(23)24-21)18(22)14(3)25-26(7,8)20(4,5)6/h9-10,14-17H,1-2,11-13H2,3-8H3/t14-,15+,16+,17-/m0/s1 |
| InChIKey | IWQHLBHTIGPZFT-HZMVEIRTSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|