C23H38O3Si — CID 102289151
(4R,5S,7S,9S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-enyl]-7,9-bis(ethenyl)-2-oxaspiro[4.4]nonan-1-one (PubChem CID 102289151) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (4R,5S,7S,9S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-enyl]-7,9-bis(ethenyl)-2-oxaspiro[4.4]nonan-1-one.
| Compound Name | (4R,5S,7S,9S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-enyl]-7,9-bis(ethenyl)-2-oxaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 102289151 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (4R,5S,7S,9S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-enyl]-7,9-bis(ethenyl)-2-oxaspiro[4.4]nonan-1-one |
| SMILES | C=C[C@H]1C[C@@H](C=C)[C@]2(C1)C(=O)OC[C@@H]2C(CC(=C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38O3Si/c1-10-17-13-18(11-2)23(14-17)19(15-25-21(23)24)20(12-16(3)4)26-27(8,9)22(5,6)7/h10-11,17-20H,1-3,12-15H2,4-9H3/t17-,18+,19+,20?,23-/m0/s1 |
| InChIKey | RLBFMYCXJSCWQA-GBWLDTBPSA-N |
| XLogP | 5.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|