C24H42O4Si — CID 52951901
[(2S)-1-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]-4-methylpent-4-en-2-yl] prop-2-enoate (PubChem CID 52951901) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is [(2S)-1-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]-4-methylpent-4-en-2-yl] prop-2-enoate.
| Compound Name | [(2S)-1-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]-4-methylpent-4-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 52951901 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | [(2S)-1-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]-4-methylpent-4-en-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H](CC(=C)C)C[C@H]1CC[C@H]([C@@H](C=C(C)C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H42O4Si/c1-11-23(25)27-20(14-17(2)3)16-19-12-13-21(26-19)22(15-18(4)5)28-29(9,10)24(6,7)8/h11,15,19-22H,1-2,12-14,16H2,3-10H3/t19-,20+,21-,22-/m1/s1 |
| InChIKey | ACPCJVCYVNTYCV-CIAFKFPVSA-N |
| XLogP | 6.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|