C17H29NO2Si — CID 102021469
(5S)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-1-prop-2-ynylpyrrolidin-2-one (PubChem CID 102021469) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is (5S)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-1-prop-2-ynylpyrrolidin-2-one.
| Compound Name | (5S)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-1-prop-2-ynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102021469 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (5S)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-1-prop-2-ynylpyrrolidin-2-one |
| SMILES | C#CCN1C(=O)CC[C@H]1C(CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H29NO2Si/c1-8-10-15(20-21(6,7)17(3,4)5)14-11-12-16(19)18(14)13-9-2/h2,8,14-15H,1,10-13H2,3-7H3/t14-,15?/m0/s1 |
| InChIKey | WUENNHOURDHFBD-MLCCFXAWSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|