C21H37NO3Si — CID 101391159
tert-butyl (1R,4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (PubChem CID 101391159) has the molecular formula C21H37NO3Si and a molecular weight of 379.62 g/mol. Its IUPAC name is tert-butyl (1R,4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
| Compound Name | tert-butyl (1R,4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 101391159 |
| Molecular Formula | C21H37NO3Si |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | tert-butyl (1R,4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@@H]2C=C[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO3Si/c1-10-11-18(25-26(8,9)21(5,6)7)16-14-15-12-13-17(16)22(15)19(23)24-20(2,3)4/h10,12-13,15-18H,1,11,14H2,2-9H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | GPEVUUIHKIVAJP-MLHJIOFPSA-N |
| XLogP | 5.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|