C23H45NO7Si2 — CID 123283969
1-O-tert-butyl 2-O,5-O-bis[tert-butyl(dimethyl)silyl] (2S,3S,5R)-3-hydroxypyrrolidine-1,2,5-tricarboxylate (PubChem CID 123283969) has the molecular formula C23H45NO7Si2 and a molecular weight of 503.79 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,5-O-bis[tert-butyl(dimethyl)silyl] (2S,3S,5R)-3-hydroxypyrrolidine-1,2,5-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,5-O-bis[tert-butyl(dimethyl)silyl] (2S,3S,5R)-3-hydroxypyrrolidine-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 123283969 |
| Molecular Formula | C23H45NO7Si2 |
| Molecular Weight | 503.79 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 1-O-tert-butyl 2-O,5-O-bis[tert-butyl(dimethyl)silyl] (2S,3S,5R)-3-hydroxypyrrolidine-1,2,5-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45NO7Si2/c1-21(2,3)29-20(28)24-15(18(26)30-32(10,11)22(4,5)6)14-16(25)17(24)19(27)31-33(12,13)23(7,8)9/h15-17,25H,14H2,1-13H3/t15-,16+,17+/m1/s1 |
| InChIKey | XIGXWOZPUGTVRZ-IKGGRYGDSA-N |
| XLogP | 4.82 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|