C18H33NO4Si — CID 12034959
tert-butyl (1R,2R,4S,5S)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate (PubChem CID 12034959) has the molecular formula C18H33NO4Si and a molecular weight of 355.55 g/mol. Its IUPAC name is tert-butyl (1R,2R,4S,5S)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate.
| Compound Name | tert-butyl (1R,2R,4S,5S)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate |
|---|---|
| PubChem CID | 12034959 |
| Molecular Formula | C18H33NO4Si |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | tert-butyl (1R,2R,4S,5S)-7-[tert-butyl(dimethyl)silyl]oxy-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC(O[Si](C)(C)C(C)(C)C)C[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C18H33NO4Si/c1-17(2,3)22-16(20)19-12-9-11(10-13(19)15-14(12)21-15)23-24(7,8)18(4,5)6/h11-15H,9-10H2,1-8H3/t11?,12-,13+,14-,15+ |
| InChIKey | HXOUGINEECKCCQ-LFAHVKQVSA-N |
| XLogP | 3.93 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|