C13H19NO5 — CID 46216978
8-O-tert-butyl 6-O-methyl (1S,2S,4R,5R,6S)-3-oxa-8-azatricyclo[3.2.1.02,4]octane-6,8-dicarboxylate (PubChem CID 46216978) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 8-O-tert-butyl 6-O-methyl (1S,2S,4R,5R,6S)-3-oxa-8-azatricyclo[3.2.1.02,4]octane-6,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 6-O-methyl (1S,2S,4R,5R,6S)-3-oxa-8-azatricyclo[3.2.1.02,4]octane-6,8-dicarboxylate |
|---|---|
| PubChem CID | 46216978 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 8-O-tert-butyl 6-O-methyl (1S,2S,4R,5R,6S)-3-oxa-8-azatricyclo[3.2.1.02,4]octane-6,8-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2[C@@H]3O[C@@H]3[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19NO5/c1-13(2,3)19-12(16)14-7-5-6(11(15)17-4)8(14)10-9(7)18-10/h6-10H,5H2,1-4H3/t6-,7-,8+,9-,10+/m0/s1 |
| InChIKey | QOGBGLYFCPSSQK-GENCIFFESA-N |
| XLogP | 0.93 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|