C22H29NO2Si — CID 102414598
(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylethynyl)-1-prop-2-ynylazetidin-2-one (PubChem CID 102414598) has the molecular formula C22H29NO2Si and a molecular weight of 367.57 g/mol. Its IUPAC name is (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylethynyl)-1-prop-2-ynylazetidin-2-one.
| Compound Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylethynyl)-1-prop-2-ynylazetidin-2-one |
|---|---|
| PubChem CID | 102414598 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylethynyl)-1-prop-2-ynylazetidin-2-one |
| SMILES | C#CCN1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C22H29NO2Si/c1-8-16-23-19(15-14-18-12-10-9-11-13-18)20(21(23)24)17(2)25-26(6,7)22(3,4)5/h1,9-13,17,19-20H,16H2,2-7H3/t17-,19-,20-/m1/s1 |
| InChIKey | KCKIVMSCYROQFN-MISYRCLQSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|