C26H41NO5SSi — CID 88602643
(2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxoazetidin-2-yl]-2-phenylpropanethioic S-acid (PubChem CID 88602643) has the molecular formula C26H41NO5SSi and a molecular weight of 507.77 g/mol. Its IUPAC name is (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxoazetidin-2-yl]-2-phenylpropanethioic S-acid.
| Compound Name | (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxoazetidin-2-yl]-2-phenylpropanethioic S-acid |
|---|---|
| PubChem CID | 88602643 |
| Molecular Formula | C26H41NO5SSi |
| Molecular Weight | 507.77 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxoazetidin-2-yl]-2-phenylpropanethioic S-acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(CC(=O)OC(C)(C)C)[C@@H]1[C@](C)(C(=O)S)c1ccccc1 |
| InChI | InChI=1S/C26H41NO5SSi/c1-17(32-34(9,10)25(5,6)7)20-21(26(8,23(30)33)18-14-12-11-13-15-18)27(22(20)29)16-19(28)31-24(2,3)4/h11-15,17,20-21H,16H2,1-10H3,(H,30,33)/t17-,20-,21+,26-/m1/s1 |
| InChIKey | OWGAVXLQBYOJAU-OQJFVQCTSA-N |
| XLogP | 4.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.77 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|