C26H50O8Si2 — CID 102182234
[(1R)-1-[(2S,3aR,5R,6aR)-5-[(1R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] acetate (PubChem CID 102182234) has the molecular formula C26H50O8Si2 and a molecular weight of 546.85 g/mol. Its IUPAC name is [(1R)-1-[(2S,3aR,5R,6aR)-5-[(1R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] acetate.
| Compound Name | [(1R)-1-[(2S,3aR,5R,6aR)-5-[(1R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] acetate |
|---|---|
| PubChem CID | 102182234 |
| Molecular Formula | C26H50O8Si2 |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | [(1R)-1-[(2S,3aR,5R,6aR)-5-[(1R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] acetate |
| SMILES | CC(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H]2O[C@@H]([C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)=O)C[C@H]2O1 |
| InChI | InChI=1S/C26H50O8Si2/c1-17(27)31-23(15-29-35(9,10)25(3,4)5)21-13-19-20(33-21)14-22(34-19)24(32-18(2)28)16-30-36(11,12)26(6,7)8/h19-24H,13-16H2,1-12H3/t19-,20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | WIROSGFRABSCQY-JHXGOWNISA-N |
| XLogP | 5.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|