C24H48O5Si2 — CID 10412557
(1S,4R,5R,7Z,9R,10S,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxabicyclo[7.3.1]tridec-7-ene-4,5-diol (PubChem CID 10412557) has the molecular formula C24H48O5Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is (1S,4R,5R,7Z,9R,10S,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxabicyclo[7.3.1]tridec-7-ene-4,5-diol.
| Compound Name | (1S,4R,5R,7Z,9R,10S,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxabicyclo[7.3.1]tridec-7-ene-4,5-diol |
|---|---|
| PubChem CID | 10412557 |
| Molecular Formula | C24H48O5Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | (1S,4R,5R,7Z,9R,10S,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxabicyclo[7.3.1]tridec-7-ene-4,5-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC[C@@H](O)[C@H](O)C/C=C\[C@H]1O2 |
| InChI | InChI=1S/C24H48O5Si2/c1-23(2,3)30(7,8)28-21-16-22(29-31(9,10)24(4,5)6)20-15-14-18(26)17(25)12-11-13-19(21)27-20/h11,13,17-22,25-26H,12,14-16H2,1-10H3/b13-11-/t17-,18-,19-,20+,21+,22-/m1/s1 |
| InChIKey | USVHEFSPJLUFDA-ATBUACEDSA-N |
| XLogP | 5.39 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|