C13H24O4Si — CID 102377682
(1S,2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]oct-6-ene-2,3-diol (PubChem CID 102377682) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is (1S,2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]oct-6-ene-2,3-diol.
| Compound Name | (1S,2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]oct-6-ene-2,3-diol |
|---|---|
| PubChem CID | 102377682 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (1S,2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]oct-6-ene-2,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C13H24O4Si/c1-13(2,3)18(4,5)17-12-9-7-6-8(16-9)10(14)11(12)15/h6-12,14-15H,1-5H3/t8-,9+,10-,11-,12+/m0/s1 |
| InChIKey | CYTGGYBVIKKBON-KZZRWZIVSA-N |
| XLogP | 1.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|