C19H36O4Si — CID 101349439
(E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,3S)-2-prop-2-enyloxan-3-yl]oxypent-2-en-1-ol (PubChem CID 101349439) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,3S)-2-prop-2-enyloxan-3-yl]oxypent-2-en-1-ol.
| Compound Name | (E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,3S)-2-prop-2-enyloxan-3-yl]oxypent-2-en-1-ol |
|---|---|
| PubChem CID | 101349439 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,3S)-2-prop-2-enyloxan-3-yl]oxypent-2-en-1-ol |
| SMILES | C=CC[C@H]1OCCC[C@@H]1O[C@@H](/C=C/CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-7-10-17-18(12-9-14-21-17)23-16(11-8-13-20)15-22-24(5,6)19(2,3)4/h7-8,11,16-18,20H,1,9-10,12-15H2,2-6H3/b11-8+/t16-,17+,18-/m0/s1 |
| InChIKey | XFRPRDAPGVLKDM-QLRBWSNQSA-N |
| XLogP | 4.07 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|