C21H38O2Si — CID 135077331
tert-butyl-[(2S,3R)-2-[(2E,5E,8E)-deca-2,5,8-trienyl]oxan-3-yl]oxy-dimethylsilane (PubChem CID 135077331) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-2-[(2E,5E,8E)-deca-2,5,8-trienyl]oxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R)-2-[(2E,5E,8E)-deca-2,5,8-trienyl]oxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135077331 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl-[(2S,3R)-2-[(2E,5E,8E)-deca-2,5,8-trienyl]oxan-3-yl]oxy-dimethylsilane |
| SMILES | C/C=C/C/C=C/C/C=C/C[C@@H]1OCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-7-8-9-10-11-12-13-14-16-19-20(17-15-18-22-19)23-24(5,6)21(2,3)4/h7-8,10-11,13-14,19-20H,9,12,15-18H2,1-6H3/b8-7+,11-10+,14-13+/t19-,20+/m0/s1 |
| InChIKey | HRWBXCSXMUCNSJ-KUOQCNDVSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|