C30H61IO5Si3 — CID 140867306
(2S,3S,4S,5R,6S)-2-but-3-enyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]oxan-3-ol (PubChem CID 140867306) has the molecular formula C30H61IO5Si3 and a molecular weight of 712.98 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-but-3-enyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]oxan-3-ol.
| Compound Name | (2S,3S,4S,5R,6S)-2-but-3-enyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]oxan-3-ol |
|---|---|
| PubChem CID | 140867306 |
| Molecular Formula | C30H61IO5Si3 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.29 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-but-3-enyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]oxan-3-ol |
| SMILES | C=CCC[C@@H]1O[C@@H]([C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C30H61IO5Si3/c1-17-18-19-22-24(32)26(35-38(13,14)29(5,6)7)27(36-39(15,16)30(8,9)10)25(33-22)23(20-21-31)34-37(11,12)28(2,3)4/h17,20-27,32H,1,18-19H2,2-16H3/b21-20+/t22-,23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | RZRBNJCLYJJJMJ-DBESYEHWSA-N |
| XLogP | 9.20 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|