C34H64O5Si2 — CID 10627540
(1S,7S,8S,9R,12R,13R)-7-butyl-12-tert-butyl-9,13-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxatricyclo[7.3.1.05,13]trideca-5,10-diene-1,8-diol (PubChem CID 10627540) has the molecular formula C34H64O5Si2 and a molecular weight of 609.05 g/mol. Its IUPAC name is (1S,7S,8S,9R,12R,13R)-7-butyl-12-tert-butyl-9,13-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxatricyclo[7.3.1.05,13]trideca-5,10-diene-1,8-diol.
| Compound Name | (1S,7S,8S,9R,12R,13R)-7-butyl-12-tert-butyl-9,13-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxatricyclo[7.3.1.05,13]trideca-5,10-diene-1,8-diol |
|---|---|
| PubChem CID | 10627540 |
| Molecular Formula | C34H64O5Si2 |
| Molecular Weight | 609.05 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | (1S,7S,8S,9R,12R,13R)-7-butyl-12-tert-butyl-9,13-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxatricyclo[7.3.1.05,13]trideca-5,10-diene-1,8-diol |
| SMILES | CCCC[C@H]1C=C2COC[C@]3(O)[C@@H](C(C)(C)C)C=C[C@@](CO[Si](C)(C)C(C)(C)C)([C@H]1O)[C@@]23CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H64O5Si2/c1-15-16-17-25-20-26-21-37-24-34(36)27(29(2,3)4)18-19-32(28(25)35,22-38-40(11,12)30(5,6)7)33(26,34)23-39-41(13,14)31(8,9)10/h18-20,25,27-28,35-36H,15-17,21-24H2,1-14H3/t25-,27+,28-,32+,33+,34-/m0/s1 |
| InChIKey | FESRILBQOJWVCW-JCAGBJEDSA-N |
| XLogP | 8.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.05 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|