C18H28O4Si — CID 10735626
tert-butyl-dimethyl-[[(1S,10S,12R,13R,14S)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradeca-4,6-dien-12-yl]methoxy]silane (PubChem CID 10735626) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,10S,12R,13R,14S)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradeca-4,6-dien-12-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,10S,12R,13R,14S)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradeca-4,6-dien-12-yl]methoxy]silane |
|---|---|
| PubChem CID | 10735626 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,10S,12R,13R,14S)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradeca-4,6-dien-12-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H]2OCC3=CC=C4CO[C@H]1[C@@H]4[C@@H]32 |
| InChI | InChI=1S/C18H28O4Si/c1-18(2,3)23(4,5)21-10-13-16-14-11(8-19-16)6-7-12-9-20-17(22-13)15(12)14/h6-7,13-17H,8-10H2,1-5H3/t13-,14+,15-,16-,17+/m1/s1 |
| InChIKey | GYCOGFFZMGBRAF-JJTUDDRGSA-N |
| XLogP | 3.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|