C19H32O4Si — CID 10594183
tert-butyl-[[(1R,2R,3S,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-dimethylsilane (PubChem CID 10594183) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,3S,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,3S,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10594183 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | tert-butyl-[[(1R,2R,3S,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1CO[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OCC(=C)[C@H]3[C@H]21 |
| InChI | InChI=1S/C19H32O4Si/c1-8-13-10-21-18-16(13)15-12(2)9-20-17(15)14(23-18)11-22-24(6,7)19(3,4)5/h8,13-18H,1-2,9-11H2,3-7H3/t13-,14-,15+,16-,17-,18+/m1/s1 |
| InChIKey | QSHXGAYGLPPELL-PNVOZDDCSA-N |
| XLogP | 3.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|