C27H48O5Si — CID 11167554
(4S,6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-3,4,5,6-tetrahydro-1H-2-benzofuran-4-ol (PubChem CID 11167554) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is (4S,6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-3,4,5,6-tetrahydro-1H-2-benzofuran-4-ol.
| Compound Name | (4S,6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-3,4,5,6-tetrahydro-1H-2-benzofuran-4-ol |
|---|---|
| PubChem CID | 11167554 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | (4S,6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-3,4,5,6-tetrahydro-1H-2-benzofuran-4-ol |
| SMILES | C/C(=C\C1OCC2=C1[C@@H](O)C[C@@H](C)[C@@]2(C)CCC1OCCO1)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O5Si/c1-19(10-9-13-32-33(7,8)26(3,4)5)16-23-25-21(18-31-23)27(6,20(2)17-22(25)28)12-11-24-29-14-15-30-24/h16,20,22-24,28H,9-15,17-18H2,1-8H3/b19-16+/t20-,22+,23?,27-/m1/s1 |
| InChIKey | FJVMNYOJIYIQRI-VLIAAPRISA-N |
| XLogP | 5.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|