C27H50O4Si — CID 101234070
tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(methoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane (PubChem CID 101234070) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(methoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(methoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101234070 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(methoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane |
| SMILES | COCOC[C@@H]1CC=C(C)[C@H](CC2=CC[C@@H](C(C)C)[C@]2(C)CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H50O4Si/c1-20(2)24-14-12-22(27(24,7)15-16-30-32(9,10)26(4,5)6)17-25-21(3)11-13-23(31-25)18-29-19-28-8/h11-12,20,23-25H,13-19H2,1-10H3/t23-,24-,25-,27+/m0/s1 |
| InChIKey | MRSBHQVVTNNVES-MVVJZGTDSA-N |
| XLogP | 7.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|