C17H34O3Si — CID 10358297
tert-butyl-[[(2S,3R,6S)-3-butyl-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane (PubChem CID 10358297) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R,6S)-3-butyl-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3R,6S)-3-butyl-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10358297 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | tert-butyl-[[(2S,3R,6S)-3-butyl-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
| SMILES | CCCC[C@@H]1C=C[C@@H](OC)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-8-9-10-14-11-12-16(18-5)20-15(14)13-19-21(6,7)17(2,3)4/h11-12,14-16H,8-10,13H2,1-7H3/t14-,15-,16+/m1/s1 |
| InChIKey | AYTMIVXUMULNJD-OAGGEKHMSA-N |
| XLogP | 4.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|