C23H42O3Si — CID 5377759
[(Z)-2-cyclohexyl-1-(2-methyl-1,4-dioxaspiro[4.5]decan-3-yl)ethenoxy]-triethylsilane (PubChem CID 5377759) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(Z)-2-cyclohexyl-1-(2-methyl-1,4-dioxaspiro[4.5]decan-3-yl)ethenoxy]-triethylsilane.
| Compound Name | [(Z)-2-cyclohexyl-1-(2-methyl-1,4-dioxaspiro[4.5]decan-3-yl)ethenoxy]-triethylsilane |
|---|---|
| PubChem CID | 5377759 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(Z)-2-cyclohexyl-1-(2-methyl-1,4-dioxaspiro[4.5]decan-3-yl)ethenoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)O/C(=C\C1CCCCC1)C1OC2(CCCCC2)OC1C |
| InChI | InChI=1S/C23H42O3Si/c1-5-27(6-2,7-3)26-21(18-20-14-10-8-11-15-20)22-19(4)24-23(25-22)16-12-9-13-17-23/h18-20,22H,5-17H2,1-4H3/b21-18- |
| InChIKey | XXWACBUULRDAFI-UZYVYHOESA-N |
| XLogP | 6.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|