C24H44O3Si — CID 140810756
tert-butyl-[(E)-5-[5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-yl]-4-methylpent-4-enoxy]-dimethylsilane (PubChem CID 140810756) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is tert-butyl-[(E)-5-[5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-yl]-4-methylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-5-[5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-yl]-4-methylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 140810756 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | tert-butyl-[(E)-5-[5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-yl]-4-methylpent-4-enoxy]-dimethylsilane |
| SMILES | C=C/C=C(\C)CCC1CC(OC)OC1/C=C(\C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O3Si/c1-10-12-19(2)14-15-21-18-23(25-7)27-22(21)17-20(3)13-11-16-26-28(8,9)24(4,5)6/h10,12,17,21-23H,1,11,13-16,18H2,2-9H3/b19-12+,20-17+ |
| InChIKey | CCPCOAVZGVYTQW-PVYFLZRGSA-N |
| XLogP | 7.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|