C25H44O4Si — CID 134872853
tert-butyl-[(E)-5-[(1R,2R,5S)-2-[(E)-2-methoxyethenyl]-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-yl]-3-methylpent-2-enoxy]-dimethylsilane (PubChem CID 134872853) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is tert-butyl-[(E)-5-[(1R,2R,5S)-2-[(E)-2-methoxyethenyl]-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-yl]-3-methylpent-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-5-[(1R,2R,5S)-2-[(E)-2-methoxyethenyl]-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-yl]-3-methylpent-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134872853 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | tert-butyl-[(E)-5-[(1R,2R,5S)-2-[(E)-2-methoxyethenyl]-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-yl]-3-methylpent-2-enoxy]-dimethylsilane |
| SMILES | CO/C=C/[C@]1(C)C=C[C@H](C2(C)OCCO2)[C@H]1CC/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O4Si/c1-20(13-16-29-30(8,9)23(2,3)4)10-11-21-22(25(6)27-18-19-28-25)12-14-24(21,5)15-17-26-7/h12-15,17,21-22H,10-11,16,18-19H2,1-9H3/b17-15+,20-13+/t21-,22+,24+/m1/s1 |
| InChIKey | CSNZFNYZWIUJOS-IOZZVURDSA-N |
| XLogP | 6.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|