C29H54O5Si — CID 101234071
tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane (PubChem CID 101234071) has the molecular formula C29H54O5Si and a molecular weight of 510.83 g/mol. Its IUPAC name is tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101234071 |
| Molecular Formula | C29H54O5Si |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | tert-butyl-[2-[(1S,5S)-2-[[(2S,6S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,6-dihydro-2H-pyran-6-yl]methyl]-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethoxy]-dimethylsilane |
| SMILES | COCCOCOC[C@@H]1CC=C(C)[C@H](CC2=CC[C@@H](C(C)C)[C@]2(C)CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H54O5Si/c1-22(2)26-14-12-24(29(26,7)15-16-33-35(9,10)28(4,5)6)19-27-23(3)11-13-25(34-27)20-32-21-31-18-17-30-8/h11-12,22,25-27H,13-21H2,1-10H3/t25-,26-,27-,29+/m0/s1 |
| InChIKey | XCWNZBJCISRYSN-PFWSVGDOSA-N |
| XLogP | 7.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|