C28H44O4Si2 — CID 10323728
[(3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]spiro[6,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol (PubChem CID 10323728) has the molecular formula C28H44O4Si2 and a molecular weight of 500.83 g/mol. Its IUPAC name is [(3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]spiro[6,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol.
| Compound Name | [(3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]spiro[6,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol |
|---|---|
| PubChem CID | 10323728 |
| Molecular Formula | C28H44O4Si2 |
| Molecular Weight | 500.83 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | [(3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]spiro[6,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]1(C#C/C=C\C#C[Si](C)(C)C)CC(CO)=C[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C28H44O4Si2/c1-26(2,3)34(7,8)32-27(16-12-9-10-15-19-33(4,5)6)21-23(22-29)20-24-25(27)31-28(30-24)17-13-11-14-18-28/h9-10,20,24-25,29H,11,13-14,17-18,21-22H2,1-8H3/b10-9-/t24-,25-,27+/m1/s1 |
| InChIKey | OVLRDJNKZPAXFW-JCSHGHDFSA-N |
| XLogP | 5.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.83 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|