C27H52O5Si2 — CID 10649437
[(2S,4R,4aR,6R,8aR)-6-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylidene-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10649437) has the molecular formula C27H52O5Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is [(2S,4R,4aR,6R,8aR)-6-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylidene-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4R,4aR,6R,8aR)-6-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylidene-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10649437 |
| Molecular Formula | C27H52O5Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | [(2S,4R,4aR,6R,8aR)-6-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylidene-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC[C@]1(OC)CC[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)C(=C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C27H52O5Si2/c1-14-15-17-27(28-9)18-16-21-24(31-27)23(32-34(12,13)26(6,7)8)20(2)22(30-21)19-29-33(10,11)25(3,4)5/h14,21-24H,1-2,15-19H2,3-13H3/t21-,22-,23-,24-,27-/m1/s1 |
| InChIKey | DCKDVYFBGRZDJF-XMPCBSOPSA-N |
| XLogP | 7.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|