C19H34O5Si — CID 10904737
tert-butyl-[[(1S,3R,8S,10R,13R)-6,6-dimethyl-12-methylidene-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]-dimethylsilane (PubChem CID 10904737) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is tert-butyl-[[(1S,3R,8S,10R,13R)-6,6-dimethyl-12-methylidene-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,3R,8S,10R,13R)-6,6-dimethyl-12-methylidene-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10904737 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | tert-butyl-[[(1S,3R,8S,10R,13R)-6,6-dimethyl-12-methylidene-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]-dimethylsilane |
| SMILES | C=C1O[C@@H]2C[C@@H]3OC(C)(C)OC[C@H]3O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O5Si/c1-12-13(24-25(7,8)18(2,3)4)9-15-14(21-12)10-16-17(22-15)11-20-19(5,6)23-16/h13-17H,1,9-11H2,2-8H3/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | MDQRCDYKEQJIOM-UHDSXZAQSA-N |
| XLogP | 3.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|