C31H63IO5Si3 — CID 123232991
[(1S)-1-[(2S,3R,4S,4aS,6S,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 123232991) has the molecular formula C31H63IO5Si3 and a molecular weight of 727.00 g/mol. Its IUPAC name is [(1S)-1-[(2S,3R,4S,4aS,6S,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-1-[(2S,3R,4S,4aS,6S,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 123232991 |
| Molecular Formula | C31H63IO5Si3 |
| Molecular Weight | 727.00 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | [(1S)-1-[(2S,3R,4S,4aS,6S,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC[C@H]1CC[C@@H]2O[C@@H]([C@H](C=CI)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C31H63IO5Si3/c1-17-22-18-19-23-25(33-22)27(36-39(13,14)30(5,6)7)28(37-40(15,16)31(8,9)10)26(34-23)24(20-21-32)35-38(11,12)29(2,3)4/h20-28H,17-19H2,1-16H3/t22-,23-,24-,25-,26-,27-,28+/m0/s1 |
| InChIKey | GJAFQXLFJOKQTJ-NHUCAYLPSA-N |
| XLogP | 9.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.00 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|