C24H44O6Si — CID 146018811
tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]silane (PubChem CID 146018811) has the molecular formula C24H44O6Si and a molecular weight of 456.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 146018811 |
| Molecular Formula | C24H44O6Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]silane |
| SMILES | C=CCO[C@H]1[C@H](OCC=C)[C@@H](OCC=C)C(OC(C)C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O6Si/c1-11-14-25-20-19(17-28-31(9,10)24(6,7)8)30-23(29-18(4)5)22(27-16-13-3)21(20)26-15-12-2/h11-13,18-23H,1-3,14-17H2,4-10H3/t19-,20-,21+,22-,23?/m1/s1 |
| InChIKey | YALAKVVNNCFFLI-HZQGQDIUSA-N |
| XLogP | 4.87 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|