C27H57FO5Si3 — CID 140966535
[(2R,3R,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-6-prop-2-enoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 140966535) has the molecular formula C27H57FO5Si3 and a molecular weight of 565.00 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-6-prop-2-enoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-6-prop-2-enoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140966535 |
| Molecular Formula | C27H57FO5Si3 |
| Molecular Weight | 565.00 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-6-prop-2-enoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](F)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H57FO5Si3/c1-17-18-29-24-23(33-36(15,16)27(8,9)10)22(32-35(13,14)26(5,6)7)21(28)20(31-24)19-30-34(11,12)25(2,3)4/h17,20-24H,1,18-19H2,2-16H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | PURVYKQYRCVZBC-SJSRKZJXSA-N |
| XLogP | 8.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.00 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|