C33H72O6Si4 — CID 67763208
triethyl-[(2S,3R,4S,5R,6R)-2-prop-1-enoxy-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane (PubChem CID 67763208) has the molecular formula C33H72O6Si4 and a molecular weight of 677.28 g/mol. Its IUPAC name is triethyl-[(2S,3R,4S,5R,6R)-2-prop-1-enoxy-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane.
| Compound Name | triethyl-[(2S,3R,4S,5R,6R)-2-prop-1-enoxy-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 67763208 |
| Molecular Formula | C33H72O6Si4 |
| Molecular Weight | 677.28 g/mol |
| Exact Mass | 676.44 |
| IUPAC Name | triethyl-[(2S,3R,4S,5R,6R)-2-prop-1-enoxy-3,5-bis(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-4-yl]oxysilane |
| SMILES | CC=CO[C@H]1O[C@H](CO[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H72O6Si4/c1-14-27-34-33-32(39-43(24-11,25-12)26-13)31(38-42(21-8,22-9)23-10)30(37-41(18-5,19-6)20-7)29(36-33)28-35-40(15-2,16-3)17-4/h14,27,29-33H,15-26,28H2,1-13H3/t29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | QDLYSNRDBQERPW-AALIFHQRSA-N |
| XLogP | 10.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.28 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|