C21H32O11Si — CID 11733660
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]oxan-2-yl]methyl acetate (PubChem CID 11733660) has the molecular formula C21H32O11Si and a molecular weight of 488.56 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11733660 |
| Molecular Formula | C21H32O11Si |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]oxan-2-yl]methyl acetate |
| SMILES | C=C(/C=C/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H32O11Si/c1-12(32-33(6,7)8)9-10-26-21-20(30-16(5)25)19(29-15(4)24)18(28-14(3)23)17(31-21)11-27-13(2)22/h9-10,17-21H,1,11H2,2-8H3/b10-9+/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | YWGRHAQLYBEGKU-ZGSCTMRNSA-N |
| XLogP | 1.97 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|