C29H60O7Si3 — CID 58751426
[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl acetate (PubChem CID 58751426) has the molecular formula C29H60O7Si3 and a molecular weight of 605.05 g/mol. Its IUPAC name is [3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58751426 |
| Molecular Formula | C29H60O7Si3 |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | [3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCOC1OC(COC(C)=O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O7Si3/c1-18-19-31-26-25(36-39(16,17)29(9,10)11)24(35-38(14,15)28(6,7)8)23(22(33-26)20-32-21(2)30)34-37(12,13)27(3,4)5/h18,22-26H,1,19-20H2,2-17H3 |
| InChIKey | KZNQJUPOMWSVPN-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|